About dichlorozirconium;5-(2-propan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene
dichlorozirconium;5-(2-propan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene (PubChem CID 174390138) has the molecular formula C24H21Cl2Zr-
and a molecular weight of 471.56 g/mol. Its IUPAC name is dichlorozirconium;5-(2-propan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene.
Molecular Properties
| Compound Name | dichlorozirconium;5-(2-propan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene |
| PubChem CID | 174390138 |
| Molecular Formula | C24H21Cl2Zr- |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 469.01 |
| IUPAC Name | dichlorozirconium;5-(2-propan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene |
| SMILES | CC(C)c1cc2c(-c3ccc4c5c(cccc35)CC4)cccc2[cH-]1.Cl[Zr]Cl |
| InChI | InChI=1S/C24H21.2ClH.Zr/c1-15(2)19-13-18-6-4-7-20(23(18)14-19)21-12-11-17-10-9-16-5-3-8-22(21)24(16)17;;;/h3-8,11-15H,9-10H2,1-2H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | WSEMNKOQMXPWKJ-UHFFFAOYSA-L |
| XLogP | 7.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dichlorozirconium;5-(2-propan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozirconium;5-(2-propan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene?
The IUPAC name of dichlorozirconium;5-(2-propan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene (CID 174390138) is dichlorozirconium;5-(2-propan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene.
What is the SMILES notation for dichlorozirconium;5-(2-propan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene?
The canonical SMILES for dichlorozirconium;5-(2-propan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene is CC(C)c1cc2c(-c3ccc4c5c(cccc35)CC4)cccc2[cH-]1.Cl[Zr]Cl.
What is the InChIKey of dichlorozirconium;5-(2-propan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene?
The InChIKey is WSEMNKOQMXPWKJ-UHFFFAOYSA-L. The full InChI is InChI=1S/C24H21.2ClH.Zr/c1-15(2)19-13-18-6-4-7-20(23(18)14-19)21-12-11-17-10-9-16-5-3-8-22(21)24(16)17;;;/h3-8,11-15H,9-10H2,1-2H3;2*1H;/q-1;;;+2/p-2.
What are the key properties of dichlorozirconium;5-(2-propan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene?
dichlorozirconium;5-(2-propan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene has a molecular weight of 471.56 g/mol, XLogP of 7.98, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozirconium;5-(2-propan-2-yl-1H-inden-1-id-4-yl)-1,2-dihydroacenaphthylene is sourced from PubChem (CID 174390138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).