C20H22O6 — CID 174391845
1-(1,3-benzodioxol-5-yl)propan-2-ol;5-(oxiran-2-ylmethyl)-1,3-benzodioxole (PubChem CID 174391845) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)propan-2-ol;5-(oxiran-2-ylmethyl)-1,3-benzodioxole.
| Compound Name | 1-(1,3-benzodioxol-5-yl)propan-2-ol;5-(oxiran-2-ylmethyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 174391845 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)propan-2-ol;5-(oxiran-2-ylmethyl)-1,3-benzodioxole |
| SMILES | CC(O)Cc1ccc2c(c1)OCO2.c1cc2c(cc1CC1CO1)OCO2 |
| InChI | InChI=1S/C10H10O3.C10H12O3/c1-2-9-10(13-6-12-9)4-7(1)3-8-5-11-8;1-7(11)4-8-2-3-9-10(5-8)13-6-12-9/h1-2,4,8H,3,5-6H2;2-3,5,7,11H,4,6H2,1H3 |
| InChIKey | OIZUUJUGJNLRRP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|