About N-[2,3-dihydro-1H-indol-6-yl-(1-ethylpiperidin-4-yl)methyl]acetamide;fluorobenzene
N-[2,3-dihydro-1H-indol-6-yl-(1-ethylpiperidin-4-yl)methyl]acetamide;fluorobenzene (PubChem CID 174392016) has the molecular formula C24H32FN3O
and a molecular weight of 397.54 g/mol. Its IUPAC name is N-[2,3-dihydro-1H-indol-6-yl-(1-ethylpiperidin-4-yl)methyl]acetamide;fluorobenzene.
Molecular Properties
| Compound Name | N-[2,3-dihydro-1H-indol-6-yl-(1-ethylpiperidin-4-yl)methyl]acetamide;fluorobenzene |
| PubChem CID | 174392016 |
| Molecular Formula | C24H32FN3O |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | N-[2,3-dihydro-1H-indol-6-yl-(1-ethylpiperidin-4-yl)methyl]acetamide;fluorobenzene |
| SMILES | CCN1CCC(C(NC(C)=O)c2ccc3c(c2)NCC3)CC1.Fc1ccccc1 |
| InChI | InChI=1S/C18H27N3O.C6H5F/c1-3-21-10-7-15(8-11-21)18(20-13(2)22)16-5-4-14-6-9-19-17(14)12-16;7-6-4-2-1-3-5-6/h4-5,12,15,18-19H,3,6-11H2,1-2H3,(H,20,22);1-5H |
| InChIKey | ZNQXAXPHRDBPRY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2,3-dihydro-1H-indol-6-yl-(1-ethylpiperidin-4-yl)methyl]acetamide;fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,3-dihydro-1H-indol-6-yl-(1-ethylpiperidin-4-yl)methyl]acetamide;fluorobenzene?
The IUPAC name of N-[2,3-dihydro-1H-indol-6-yl-(1-ethylpiperidin-4-yl)methyl]acetamide;fluorobenzene (CID 174392016) is N-[2,3-dihydro-1H-indol-6-yl-(1-ethylpiperidin-4-yl)methyl]acetamide;fluorobenzene.
What is the SMILES notation for N-[2,3-dihydro-1H-indol-6-yl-(1-ethylpiperidin-4-yl)methyl]acetamide;fluorobenzene?
The canonical SMILES for N-[2,3-dihydro-1H-indol-6-yl-(1-ethylpiperidin-4-yl)methyl]acetamide;fluorobenzene is CCN1CCC(C(NC(C)=O)c2ccc3c(c2)NCC3)CC1.Fc1ccccc1.
What is the InChIKey of N-[2,3-dihydro-1H-indol-6-yl-(1-ethylpiperidin-4-yl)methyl]acetamide;fluorobenzene?
The InChIKey is ZNQXAXPHRDBPRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3O.C6H5F/c1-3-21-10-7-15(8-11-21)18(20-13(2)22)16-5-4-14-6-9-19-17(14)12-16;7-6-4-2-1-3-5-6/h4-5,12,15,18-19H,3,6-11H2,1-2H3,(H,20,22);1-5H.
What are the key properties of N-[2,3-dihydro-1H-indol-6-yl-(1-ethylpiperidin-4-yl)methyl]acetamide;fluorobenzene?
N-[2,3-dihydro-1H-indol-6-yl-(1-ethylpiperidin-4-yl)methyl]acetamide;fluorobenzene has a molecular weight of 397.54 g/mol, XLogP of 4.39, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,3-dihydro-1H-indol-6-yl-(1-ethylpiperidin-4-yl)methyl]acetamide;fluorobenzene is sourced from PubChem (CID 174392016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).