C22H32O5 — CID 174392597
methyl 4-oxo-2,2-bis(2-oxobutyl)hexanoate;toluene (PubChem CID 174392597) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is methyl 4-oxo-2,2-bis(2-oxobutyl)hexanoate;toluene.
| Compound Name | methyl 4-oxo-2,2-bis(2-oxobutyl)hexanoate;toluene |
|---|---|
| PubChem CID | 174392597 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | methyl 4-oxo-2,2-bis(2-oxobutyl)hexanoate;toluene |
| SMILES | CCC(=O)CC(CC(=O)CC)(CC(=O)CC)C(=O)OC.Cc1ccccc1 |
| InChI | InChI=1S/C15H24O5.C7H8/c1-5-11(16)8-15(14(19)20-4,9-12(17)6-2)10-13(18)7-3;1-7-5-3-2-4-6-7/h5-10H2,1-4H3;2-6H,1H3 |
| InChIKey | QGHWVGSKOXAZIJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |