About cyclohexanone;pentan-3-one;toluene
cyclohexanone;pentan-3-one;toluene (PubChem CID 70449041) has the molecular formula C18H28O2
and a molecular weight of 276.42 g/mol. Its IUPAC name is cyclohexanone;pentan-3-one;toluene.
Molecular Properties
| Compound Name | cyclohexanone;pentan-3-one;toluene |
| PubChem CID | 70449041 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | cyclohexanone;pentan-3-one;toluene |
| SMILES | CCC(=O)CC.Cc1ccccc1.O=C1CCCCC1 |
| InChI | InChI=1S/C7H8.C6H10O.C5H10O/c1-7-5-3-2-4-6-7;7-6-4-2-1-3-5-6;1-3-5(6)4-2/h2-6H,1H3;1-5H2;3-4H2,1-2H3 |
| InChIKey | OOZVSADASBYNJY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexanone;pentan-3-one;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanone;pentan-3-one;toluene?
The IUPAC name of cyclohexanone;pentan-3-one;toluene (CID 70449041) is cyclohexanone;pentan-3-one;toluene.
What is the SMILES notation for cyclohexanone;pentan-3-one;toluene?
The canonical SMILES for cyclohexanone;pentan-3-one;toluene is CCC(=O)CC.Cc1ccccc1.O=C1CCCCC1.
What is the InChIKey of cyclohexanone;pentan-3-one;toluene?
The InChIKey is OOZVSADASBYNJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8.C6H10O.C5H10O/c1-7-5-3-2-4-6-7;7-6-4-2-1-3-5-6;1-3-5(6)4-2/h2-6H,1H3;1-5H2;3-4H2,1-2H3.
What are the key properties of cyclohexanone;pentan-3-one;toluene?
cyclohexanone;pentan-3-one;toluene has a molecular weight of 276.42 g/mol, XLogP of 4.89, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanone;pentan-3-one;toluene is sourced from PubChem (CID 70449041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).