C13H24N2O2S — CID 174393975
2-butyl-1-(4-ethylsulfonylbutyl)imidazole (PubChem CID 174393975) has the molecular formula C13H24N2O2S and a molecular weight of 272.41 g/mol. Its IUPAC name is 2-butyl-1-(4-ethylsulfonylbutyl)imidazole.
| Compound Name | 2-butyl-1-(4-ethylsulfonylbutyl)imidazole |
|---|---|
| PubChem CID | 174393975 |
| Molecular Formula | C13H24N2O2S |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2-butyl-1-(4-ethylsulfonylbutyl)imidazole |
| SMILES | CCCCc1nccn1CCCCS(=O)(=O)CC |
| InChI | InChI=1S/C13H24N2O2S/c1-3-5-8-13-14-9-11-15(13)10-6-7-12-18(16,17)4-2/h9,11H,3-8,10,12H2,1-2H3 |
| InChIKey | HTZWZSWQUBGLSD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|