C25H32F2N4O2 — CID 174397651
N-[1-[(3,5-diaminophenyl)methyl]piperidin-4-yl]-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetamide (PubChem CID 174397651) has the molecular formula C25H32F2N4O2 and a molecular weight of 458.55 g/mol. Its IUPAC name is N-[1-[(3,5-diaminophenyl)methyl]piperidin-4-yl]-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetamide.
| Compound Name | N-[1-[(3,5-diaminophenyl)methyl]piperidin-4-yl]-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 174397651 |
| Molecular Formula | C25H32F2N4O2 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | N-[1-[(3,5-diaminophenyl)methyl]piperidin-4-yl]-2-[(1R)-3,3-difluorocyclopentyl]-2-hydroxy-2-phenylacetamide |
| SMILES | Nc1cc(N)cc(CN2CCC(NC(=O)C(O)(c3ccccc3)[C@@H]3CCC(F)(F)C3)CC2)c1 |
| InChI | InChI=1S/C25H32F2N4O2/c26-24(27)9-6-19(15-24)25(33,18-4-2-1-3-5-18)23(32)30-22-7-10-31(11-8-22)16-17-12-20(28)14-21(29)13-17/h1-5,12-14,19,22,33H,6-11,15-16,28-29H2,(H,30,32)/t19-,25?/m1/s1 |
| InChIKey | RAECMQBWGMLWIA-OEPVSBQMSA-N |
| XLogP | 3.25 |
| TPSA | 104.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|