C24H34N2O2 — CID 18922005
N-[1-(cyclopenten-1-ylmethyl)piperidin-4-yl]-2-cyclopentyl-2-hydroxy-2-phenylacetamide (PubChem CID 18922005) has the molecular formula C24H34N2O2 and a molecular weight of 382.55 g/mol. Its IUPAC name is N-[1-(cyclopenten-1-ylmethyl)piperidin-4-yl]-2-cyclopentyl-2-hydroxy-2-phenylacetamide.
| Compound Name | N-[1-(cyclopenten-1-ylmethyl)piperidin-4-yl]-2-cyclopentyl-2-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 18922005 |
| Molecular Formula | C24H34N2O2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | N-[1-(cyclopenten-1-ylmethyl)piperidin-4-yl]-2-cyclopentyl-2-hydroxy-2-phenylacetamide |
| SMILES | O=C(NC1CCN(CC2=CCCC2)CC1)C(O)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C24H34N2O2/c27-23(24(28,21-12-6-7-13-21)20-10-2-1-3-11-20)25-22-14-16-26(17-15-22)18-19-8-4-5-9-19/h1-3,8,10-11,21-22,28H,4-7,9,12-18H2,(H,25,27) |
| InChIKey | AIHWFIGCNHMACA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|