C26H38N2O2 — CID 18922048
2-cyclopentyl-2-hydroxy-N-[1-[2-(5-methylcyclopenten-1-yl)ethyl]piperidin-4-yl]-2-phenylacetamide (PubChem CID 18922048) has the molecular formula C26H38N2O2 and a molecular weight of 410.60 g/mol. Its IUPAC name is 2-cyclopentyl-2-hydroxy-N-[1-[2-(5-methylcyclopenten-1-yl)ethyl]piperidin-4-yl]-2-phenylacetamide.
| Compound Name | 2-cyclopentyl-2-hydroxy-N-[1-[2-(5-methylcyclopenten-1-yl)ethyl]piperidin-4-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 18922048 |
| Molecular Formula | C26H38N2O2 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | 2-cyclopentyl-2-hydroxy-N-[1-[2-(5-methylcyclopenten-1-yl)ethyl]piperidin-4-yl]-2-phenylacetamide |
| SMILES | CC1CCC=C1CCN1CCC(NC(=O)C(O)(c2ccccc2)C2CCCC2)CC1 |
| InChI | InChI=1S/C26H38N2O2/c1-20-8-7-9-21(20)14-17-28-18-15-24(16-19-28)27-25(29)26(30,23-12-5-6-13-23)22-10-3-2-4-11-22/h2-4,9-11,20,23-24,30H,5-8,12-19H2,1H3,(H,27,29) |
| InChIKey | DCVAMRGWJOJAHQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|