C24H35FN2O2 — CID 102016689
(2R)-2-[(3S)-3-fluorocyclopentyl]-2-hydroxy-N-[1-(4-methylpent-3-enyl)piperidin-4-yl]-2-phenylacetamide (PubChem CID 102016689) has the molecular formula C24H35FN2O2 and a molecular weight of 402.55 g/mol. Its IUPAC name is (2R)-2-[(3S)-3-fluorocyclopentyl]-2-hydroxy-N-[1-(4-methylpent-3-enyl)piperidin-4-yl]-2-phenylacetamide.
| Compound Name | (2R)-2-[(3S)-3-fluorocyclopentyl]-2-hydroxy-N-[1-(4-methylpent-3-enyl)piperidin-4-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 102016689 |
| Molecular Formula | C24H35FN2O2 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | (2R)-2-[(3S)-3-fluorocyclopentyl]-2-hydroxy-N-[1-(4-methylpent-3-enyl)piperidin-4-yl]-2-phenylacetamide |
| SMILES | CC(C)=CCCN1CCC(NC(=O)[C@](O)(c2ccccc2)C2CC[C@H](F)C2)CC1 |
| InChI | InChI=1S/C24H35FN2O2/c1-18(2)7-6-14-27-15-12-22(13-16-27)26-23(28)24(29,19-8-4-3-5-9-19)20-10-11-21(25)17-20/h3-5,7-9,20-22,29H,6,10-17H2,1-2H3,(H,26,28)/t20?,21-,24-/m0/s1 |
| InChIKey | MXMXMYWNGBMDEJ-AVJWOPLCSA-N |
| XLogP | 3.95 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|