About 5,6-diphenyl-1H-indole
5,6-diphenyl-1H-indole (PubChem CID 174399063) has the molecular formula C20H15N
and a molecular weight of 269.35 g/mol. Its IUPAC name is 5,6-diphenyl-1H-indole.
Molecular Properties
| Compound Name | 5,6-diphenyl-1H-indole |
| PubChem CID | 174399063 |
| Molecular Formula | C20H15N |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 5,6-diphenyl-1H-indole |
| SMILES | c1ccc(-c2cc3cc[nH]c3cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H15N/c1-3-7-15(8-4-1)18-13-17-11-12-21-20(17)14-19(18)16-9-5-2-6-10-16/h1-14,21H |
| InChIKey | YVCKUBIUUOMOGQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5,6-diphenyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-diphenyl-1H-indole?
The IUPAC name of 5,6-diphenyl-1H-indole (CID 174399063) is 5,6-diphenyl-1H-indole.
What is the SMILES notation for 5,6-diphenyl-1H-indole?
The canonical SMILES for 5,6-diphenyl-1H-indole is c1ccc(-c2cc3cc[nH]c3cc2-c2ccccc2)cc1.
What is the InChIKey of 5,6-diphenyl-1H-indole?
The InChIKey is YVCKUBIUUOMOGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N/c1-3-7-15(8-4-1)18-13-17-11-12-21-20(17)14-19(18)16-9-5-2-6-10-16/h1-14,21H.
What are the key properties of 5,6-diphenyl-1H-indole?
5,6-diphenyl-1H-indole has a molecular weight of 269.35 g/mol, XLogP of 5.50, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-diphenyl-1H-indole is sourced from PubChem (CID 174399063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).