About dimethylamino formate;zinc
dimethylamino formate;zinc (PubChem CID 174400064) has the molecular formula C3H7NO2Zn
and a molecular weight of 154.48 g/mol. Its IUPAC name is dimethylamino formate;zinc.
Molecular Properties
| Compound Name | dimethylamino formate;zinc |
| PubChem CID | 174400064 |
| Molecular Formula | C3H7NO2Zn |
| Molecular Weight | 154.48 g/mol |
| Exact Mass | 152.98 |
| IUPAC Name | dimethylamino formate;zinc |
| SMILES | CN(C)OC=O.[Zn] |
| InChI | InChI=1S/C3H7NO2.Zn/c1-4(2)6-3-5;/h3H,1-2H3; |
| InChIKey | JBBPITZJOJFMID-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.48 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dimethylamino formate;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylamino formate;zinc?
The IUPAC name of dimethylamino formate;zinc (CID 174400064) is dimethylamino formate;zinc.
What is the SMILES notation for dimethylamino formate;zinc?
The canonical SMILES for dimethylamino formate;zinc is CN(C)OC=O.[Zn].
What is the InChIKey of dimethylamino formate;zinc?
The InChIKey is JBBPITZJOJFMID-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO2.Zn/c1-4(2)6-3-5;/h3H,1-2H3;.
What are the key properties of dimethylamino formate;zinc?
dimethylamino formate;zinc has a molecular weight of 154.48 g/mol, XLogP of -0.37, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylamino formate;zinc is sourced from PubChem (CID 174400064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).