About CID 174402343
CID 174402343 (PubChem CID 174402343) has the molecular formula C24H32BO2
and a molecular weight of 363.33 g/mol.
Molecular Properties
| Compound Name | CID 174402343 |
| PubChem CID | 174402343 |
| Molecular Formula | C24H32BO2 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | — |
| SMILES | CCCCCC(CC)OC(=O)[C@]([B]c1ccccc1)(CC)c1ccccc1 |
| InChI | InChI=1S/C24H32BO2/c1-4-7-10-19-22(5-2)27-23(26)24(6-3,20-15-11-8-12-16-20)25-21-17-13-9-14-18-21/h8-9,11-18,22H,4-7,10,19H2,1-3H3/t22?,24-/m0/s1 |
| InChIKey | BXDHWKANYOKHMN-GITCGBDTSA-N |
| XLogP | 5.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174402343 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174402343?
The IUPAC name of CID 174402343 (CID 174402343) is not available.
What is the SMILES notation for CID 174402343?
The canonical SMILES for CID 174402343 is CCCCCC(CC)OC(=O)[C@]([B]c1ccccc1)(CC)c1ccccc1.
What is the InChIKey of CID 174402343?
The InChIKey is BXDHWKANYOKHMN-GITCGBDTSA-N. The full InChI is InChI=1S/C24H32BO2/c1-4-7-10-19-22(5-2)27-23(26)24(6-3,20-15-11-8-12-16-20)25-21-17-13-9-14-18-21/h8-9,11-18,22H,4-7,10,19H2,1-3H3/t22?,24-/m0/s1.
What are the key properties of CID 174402343?
CID 174402343 has a molecular weight of 363.33 g/mol, XLogP of 5.22, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174402343 is sourced from PubChem (CID 174402343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).