C24H31ClO3 — CID 175036101
octan-3-yl 2-[(3-chlorophenyl)methyl]-3-hydroxy-2-phenylpropanoate (PubChem CID 175036101) has the molecular formula C24H31ClO3 and a molecular weight of 402.96 g/mol. Its IUPAC name is octan-3-yl 2-[(3-chlorophenyl)methyl]-3-hydroxy-2-phenylpropanoate.
| Compound Name | octan-3-yl 2-[(3-chlorophenyl)methyl]-3-hydroxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 175036101 |
| Molecular Formula | C24H31ClO3 |
| Molecular Weight | 402.96 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | octan-3-yl 2-[(3-chlorophenyl)methyl]-3-hydroxy-2-phenylpropanoate |
| SMILES | CCCCCC(CC)OC(=O)C(CO)(Cc1cccc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C24H31ClO3/c1-3-5-7-15-22(4-2)28-23(27)24(18-26,20-12-8-6-9-13-20)17-19-11-10-14-21(25)16-19/h6,8-14,16,22,26H,3-5,7,15,17-18H2,1-2H3 |
| InChIKey | OTNASWCDOQQSEF-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.96 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|