C22H17BrN2O5S — CID 174404285
[2-[[2-bromo-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]thiophen-3-yl] prop-2-enoate (PubChem CID 174404285) has the molecular formula C22H17BrN2O5S and a molecular weight of 501.36 g/mol. Its IUPAC name is [2-[[2-bromo-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]thiophen-3-yl] prop-2-enoate.
| Compound Name | [2-[[2-bromo-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]thiophen-3-yl] prop-2-enoate |
|---|---|
| PubChem CID | 174404285 |
| Molecular Formula | C22H17BrN2O5S |
| Molecular Weight | 501.36 g/mol |
| Exact Mass | 500.00 |
| IUPAC Name | [2-[[2-bromo-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]thiophen-3-yl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccsc1NC(=O)c1ccc(C(=O)NCc2cccc(O)c2)cc1Br |
| InChI | InChI=1S/C22H17BrN2O5S/c1-2-19(27)30-18-8-9-31-22(18)25-21(29)16-7-6-14(11-17(16)23)20(28)24-12-13-4-3-5-15(26)10-13/h2-11,26H,1,12H2,(H,24,28)(H,25,29) |
| InChIKey | UTDXYWOPNQRUSG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|