C22H18BrN3O5S — CID 23560605
(E)-2-[[2-bromo-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoic acid (PubChem CID 23560605) has the molecular formula C22H18BrN3O5S and a molecular weight of 516.37 g/mol. Its IUPAC name is (E)-2-[[2-bromo-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoic acid.
| Compound Name | (E)-2-[[2-bromo-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 23560605 |
| Molecular Formula | C22H18BrN3O5S |
| Molecular Weight | 516.37 g/mol |
| Exact Mass | 515.02 |
| IUPAC Name | (E)-2-[[2-bromo-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoic acid |
| SMILES | Cc1nc(/C=C(/NC(=O)c2ccc(C(=O)NCc3cccc(O)c3)cc2Br)C(=O)O)cs1 |
| InChI | InChI=1S/C22H18BrN3O5S/c1-12-25-15(11-32-12)9-19(22(30)31)26-21(29)17-6-5-14(8-18(17)23)20(28)24-10-13-3-2-4-16(27)7-13/h2-9,11,27H,10H2,1H3,(H,24,28)(H,26,29)(H,30,31)/b19-9+ |
| InChIKey | CXOUZDYTYXOIGV-DJKKODMXSA-N |
| XLogP | 3.71 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|