C28H23N3O5 — CID 70028015
2-[[4-[(3-hydroxyphenyl)methylcarbamoyl]-2-methylbenzoyl]amino]-3-quinolin-3-ylprop-2-enoic acid (PubChem CID 70028015) has the molecular formula C28H23N3O5 and a molecular weight of 481.51 g/mol. Its IUPAC name is 2-[[4-[(3-hydroxyphenyl)methylcarbamoyl]-2-methylbenzoyl]amino]-3-quinolin-3-ylprop-2-enoic acid.
| Compound Name | 2-[[4-[(3-hydroxyphenyl)methylcarbamoyl]-2-methylbenzoyl]amino]-3-quinolin-3-ylprop-2-enoic acid |
|---|---|
| PubChem CID | 70028015 |
| Molecular Formula | C28H23N3O5 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 2-[[4-[(3-hydroxyphenyl)methylcarbamoyl]-2-methylbenzoyl]amino]-3-quinolin-3-ylprop-2-enoic acid |
| SMILES | Cc1cc(C(=O)NCc2cccc(O)c2)ccc1C(=O)NC(=Cc1cnc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C28H23N3O5/c1-17-11-21(26(33)30-15-18-5-4-7-22(32)13-18)9-10-23(17)27(34)31-25(28(35)36)14-19-12-20-6-2-3-8-24(20)29-16-19/h2-14,16,32H,15H2,1H3,(H,30,33)(H,31,34)(H,35,36) |
| InChIKey | KZOJROVNXKLKRW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|