C30H23ClN4O4 — CID 70028702
methyl (Z)-2-[[2-chloro-4-(1H-indol-6-ylmethylcarbamoyl)benzoyl]amino]-3-quinolin-3-ylprop-2-enoate (PubChem CID 70028702) has the molecular formula C30H23ClN4O4 and a molecular weight of 538.99 g/mol. Its IUPAC name is methyl (Z)-2-[[2-chloro-4-(1H-indol-6-ylmethylcarbamoyl)benzoyl]amino]-3-quinolin-3-ylprop-2-enoate.
| Compound Name | methyl (Z)-2-[[2-chloro-4-(1H-indol-6-ylmethylcarbamoyl)benzoyl]amino]-3-quinolin-3-ylprop-2-enoate |
|---|---|
| PubChem CID | 70028702 |
| Molecular Formula | C30H23ClN4O4 |
| Molecular Weight | 538.99 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | methyl (Z)-2-[[2-chloro-4-(1H-indol-6-ylmethylcarbamoyl)benzoyl]amino]-3-quinolin-3-ylprop-2-enoate |
| SMILES | COC(=O)/C(=C/c1cnc2ccccc2c1)NC(=O)c1ccc(C(=O)NCc2ccc3cc[nH]c3c2)cc1Cl |
| InChI | InChI=1S/C30H23ClN4O4/c1-39-30(38)27(14-19-12-21-4-2-3-5-25(21)33-17-19)35-29(37)23-9-8-22(15-24(23)31)28(36)34-16-18-6-7-20-10-11-32-26(20)13-18/h2-15,17,32H,16H2,1H3,(H,34,36)(H,35,37)/b27-14- |
| InChIKey | IFXNNFCTOIOMOC-VYYCAZPPSA-N |
| XLogP | 5.24 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.99 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|