C33H25Cl2N3O4 — CID 59038363
methyl (Z)-2-[[2,6-dichloro-4-[[(1R)-1-naphthalen-1-ylethyl]carbamoyl]benzoyl]amino]-3-quinolin-3-ylprop-2-enoate (PubChem CID 59038363) has the molecular formula C33H25Cl2N3O4 and a molecular weight of 598.49 g/mol. Its IUPAC name is methyl (Z)-2-[[2,6-dichloro-4-[[(1R)-1-naphthalen-1-ylethyl]carbamoyl]benzoyl]amino]-3-quinolin-3-ylprop-2-enoate.
| Compound Name | methyl (Z)-2-[[2,6-dichloro-4-[[(1R)-1-naphthalen-1-ylethyl]carbamoyl]benzoyl]amino]-3-quinolin-3-ylprop-2-enoate |
|---|---|
| PubChem CID | 59038363 |
| Molecular Formula | C33H25Cl2N3O4 |
| Molecular Weight | 598.49 g/mol |
| Exact Mass | 597.12 |
| IUPAC Name | methyl (Z)-2-[[2,6-dichloro-4-[[(1R)-1-naphthalen-1-ylethyl]carbamoyl]benzoyl]amino]-3-quinolin-3-ylprop-2-enoate |
| SMILES | COC(=O)/C(=C/c1cnc2ccccc2c1)NC(=O)c1c(Cl)cc(C(=O)N[C@H](C)c2cccc3ccccc23)cc1Cl |
| InChI | InChI=1S/C33H25Cl2N3O4/c1-19(24-12-7-10-21-8-3-5-11-25(21)24)37-31(39)23-16-26(34)30(27(35)17-23)32(40)38-29(33(41)42-2)15-20-14-22-9-4-6-13-28(22)36-18-20/h3-19H,1-2H3,(H,37,39)(H,38,40)/b29-15-/t19-/m1/s1 |
| InChIKey | XIHYHWYGVQIIAM-NFBCLFKXSA-N |
| XLogP | 7.13 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.49 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|