C22H19ClN4O5S — CID 23560793
methyl (Z)-3-(2-amino-1,3-thiazol-5-yl)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]prop-2-enoate (PubChem CID 23560793) has the molecular formula C22H19ClN4O5S and a molecular weight of 486.94 g/mol. Its IUPAC name is methyl (Z)-3-(2-amino-1,3-thiazol-5-yl)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]prop-2-enoate.
| Compound Name | methyl (Z)-3-(2-amino-1,3-thiazol-5-yl)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]prop-2-enoate |
|---|---|
| PubChem CID | 23560793 |
| Molecular Formula | C22H19ClN4O5S |
| Molecular Weight | 486.94 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | methyl (Z)-3-(2-amino-1,3-thiazol-5-yl)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]prop-2-enoate |
| SMILES | COC(=O)/C(=C/c1cnc(N)s1)NC(=O)c1ccc(C(=O)NCc2cccc(O)c2)cc1Cl |
| InChI | InChI=1S/C22H19ClN4O5S/c1-32-21(31)18(9-15-11-26-22(24)33-15)27-20(30)16-6-5-13(8-17(16)23)19(29)25-10-12-3-2-4-14(28)7-12/h2-9,11,28H,10H2,1H3,(H2,24,26)(H,25,29)(H,27,30)/b18-9- |
| InChIKey | VAOVDPQOJXNLKC-NVMNQCDNSA-N |
| XLogP | 2.96 |
| TPSA | 143.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.94 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|