C27H21BrN2O5S — CID 59038378
methyl (Z)-3-(1-benzothiophen-3-yl)-2-[[2-bromo-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]prop-2-enoate (PubChem CID 59038378) has the molecular formula C27H21BrN2O5S and a molecular weight of 565.45 g/mol. Its IUPAC name is methyl (Z)-3-(1-benzothiophen-3-yl)-2-[[2-bromo-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]prop-2-enoate.
| Compound Name | methyl (Z)-3-(1-benzothiophen-3-yl)-2-[[2-bromo-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]prop-2-enoate |
|---|---|
| PubChem CID | 59038378 |
| Molecular Formula | C27H21BrN2O5S |
| Molecular Weight | 565.45 g/mol |
| Exact Mass | 564.04 |
| IUPAC Name | methyl (Z)-3-(1-benzothiophen-3-yl)-2-[[2-bromo-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]prop-2-enoate |
| SMILES | COC(=O)/C(=C/c1csc2ccccc12)NC(=O)c1ccc(C(=O)NCc2cccc(O)c2)cc1Br |
| InChI | InChI=1S/C27H21BrN2O5S/c1-35-27(34)23(13-18-15-36-24-8-3-2-7-20(18)24)30-26(33)21-10-9-17(12-22(21)28)25(32)29-14-16-5-4-6-19(31)11-16/h2-13,15,31H,14H2,1H3,(H,29,32)(H,30,33)/b23-13- |
| InChIKey | IGAHNTHKTPSPJE-QRVIBDJDSA-N |
| XLogP | 5.24 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|