C25H18Cl2N2O7 — CID 70030291
3-(6-chloro-1,3-benzodioxol-5-yl)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]prop-2-enoic acid (PubChem CID 70030291) has the molecular formula C25H18Cl2N2O7 and a molecular weight of 529.33 g/mol. Its IUPAC name is 3-(6-chloro-1,3-benzodioxol-5-yl)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]prop-2-enoic acid.
| Compound Name | 3-(6-chloro-1,3-benzodioxol-5-yl)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]prop-2-enoic acid |
|---|---|
| PubChem CID | 70030291 |
| Molecular Formula | C25H18Cl2N2O7 |
| Molecular Weight | 529.33 g/mol |
| Exact Mass | 528.05 |
| IUPAC Name | 3-(6-chloro-1,3-benzodioxol-5-yl)-2-[[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]amino]prop-2-enoic acid |
| SMILES | O=C(O)C(=Cc1cc2c(cc1Cl)OCO2)NC(=O)c1ccc(C(=O)NCc2cccc(O)c2)cc1Cl |
| InChI | InChI=1S/C25H18Cl2N2O7/c26-18-10-22-21(35-12-36-22)9-15(18)8-20(25(33)34)29-24(32)17-5-4-14(7-19(17)27)23(31)28-11-13-2-1-3-16(30)6-13/h1-10,30H,11-12H2,(H,28,31)(H,29,32)(H,33,34) |
| InChIKey | BWABWWNCFTWQBC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|