C25H28N2O5 — CID 174405331
(3-hydroxy-5-pyridin-3-ylpentan-2-yl) carbamate;4-methyl-3-phenylbenzoic acid (PubChem CID 174405331) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is (3-hydroxy-5-pyridin-3-ylpentan-2-yl) carbamate;4-methyl-3-phenylbenzoic acid.
| Compound Name | (3-hydroxy-5-pyridin-3-ylpentan-2-yl) carbamate;4-methyl-3-phenylbenzoic acid |
|---|---|
| PubChem CID | 174405331 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | (3-hydroxy-5-pyridin-3-ylpentan-2-yl) carbamate;4-methyl-3-phenylbenzoic acid |
| SMILES | CC(OC(N)=O)C(O)CCc1cccnc1.Cc1ccc(C(=O)O)cc1-c1ccccc1 |
| InChI | InChI=1S/C14H12O2.C11H16N2O3/c1-10-7-8-12(14(15)16)9-13(10)11-5-3-2-4-6-11;1-8(16-11(12)15)10(14)5-4-9-3-2-6-13-7-9/h2-9H,1H3,(H,15,16);2-3,6-8,10,14H,4-5H2,1H3,(H2,12,15) |
| InChIKey | WBIBALMPLMKSJM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |