C10H16O8 — CID 174406722
[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(1-hydroxy-2-oxopropyl)oxan-2-yl] acetate (PubChem CID 174406722) has the molecular formula C10H16O8 and a molecular weight of 264.23 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(1-hydroxy-2-oxopropyl)oxan-2-yl] acetate.
| Compound Name | [(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(1-hydroxy-2-oxopropyl)oxan-2-yl] acetate |
|---|---|
| PubChem CID | 174406722 |
| Molecular Formula | C10H16O8 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | [(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(1-hydroxy-2-oxopropyl)oxan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1O[C@H](C(O)C(C)=O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H16O8/c1-3(11)5(13)9-7(15)6(14)8(16)10(18-9)17-4(2)12/h5-10,13-16H,1-2H3/t5?,6-,7-,8+,9+,10+/m0/s1 |
| InChIKey | DDOSLMHRRWZRHX-RZYIDWRCSA-N |
| XLogP | -2.69 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |