C15H22ClN3O4 — CID 174407187
[4-chloro-5-[methyl(propan-2-yl)amino]-2-nitrophenyl] N-tert-butylcarbamate (PubChem CID 174407187) has the molecular formula C15H22ClN3O4 and a molecular weight of 343.81 g/mol. Its IUPAC name is [4-chloro-5-[methyl(propan-2-yl)amino]-2-nitrophenyl] N-tert-butylcarbamate.
| Compound Name | [4-chloro-5-[methyl(propan-2-yl)amino]-2-nitrophenyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174407187 |
| Molecular Formula | C15H22ClN3O4 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | [4-chloro-5-[methyl(propan-2-yl)amino]-2-nitrophenyl] N-tert-butylcarbamate |
| SMILES | CC(C)N(C)c1cc(OC(=O)NC(C)(C)C)c([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C15H22ClN3O4/c1-9(2)18(6)11-8-13(12(19(21)22)7-10(11)16)23-14(20)17-15(3,4)5/h7-9H,1-6H3,(H,17,20) |
| InChIKey | AHOGEIYPHBNXED-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|