C14H22ClN3O2 — CID 174407189
[2-amino-4-chloro-5-[ethyl(methyl)amino]phenyl] N-tert-butylcarbamate (PubChem CID 174407189) has the molecular formula C14H22ClN3O2 and a molecular weight of 299.80 g/mol. Its IUPAC name is [2-amino-4-chloro-5-[ethyl(methyl)amino]phenyl] N-tert-butylcarbamate.
| Compound Name | [2-amino-4-chloro-5-[ethyl(methyl)amino]phenyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174407189 |
| Molecular Formula | C14H22ClN3O2 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | [2-amino-4-chloro-5-[ethyl(methyl)amino]phenyl] N-tert-butylcarbamate |
| SMILES | CCN(C)c1cc(OC(=O)NC(C)(C)C)c(N)cc1Cl |
| InChI | InChI=1S/C14H22ClN3O2/c1-6-18(5)11-8-12(10(16)7-9(11)15)20-13(19)17-14(2,3)4/h7-8H,6,16H2,1-5H3,(H,17,19) |
| InChIKey | QCPHACUMBIPNNJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|