C13H17F3N2O2 — CID 174510277
[2-amino-4-methyl-5-(trifluoromethyl)phenyl] N-tert-butylcarbamate (PubChem CID 174510277) has the molecular formula C13H17F3N2O2 and a molecular weight of 290.29 g/mol. Its IUPAC name is [2-amino-4-methyl-5-(trifluoromethyl)phenyl] N-tert-butylcarbamate.
| Compound Name | [2-amino-4-methyl-5-(trifluoromethyl)phenyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174510277 |
| Molecular Formula | C13H17F3N2O2 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | [2-amino-4-methyl-5-(trifluoromethyl)phenyl] N-tert-butylcarbamate |
| SMILES | Cc1cc(N)c(OC(=O)NC(C)(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C13H17F3N2O2/c1-7-5-9(17)10(6-8(7)13(14,15)16)20-11(19)18-12(2,3)4/h5-6H,17H2,1-4H3,(H,18,19) |
| InChIKey | OTWDYEUIQXQFTP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|