C17H28N4O2 — CID 175110263
[2-amino-5-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]phenyl] N-tert-butylcarbamate (PubChem CID 175110263) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is [2-amino-5-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]phenyl] N-tert-butylcarbamate.
| Compound Name | [2-amino-5-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]phenyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 175110263 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | [2-amino-5-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]phenyl] N-tert-butylcarbamate |
| SMILES | CN(C)[C@H]1CCN(c2ccc(N)c(OC(=O)NC(C)(C)C)c2)C1 |
| InChI | InChI=1S/C17H28N4O2/c1-17(2,3)19-16(22)23-15-10-12(6-7-14(15)18)21-9-8-13(11-21)20(4)5/h6-7,10,13H,8-9,11,18H2,1-5H3,(H,19,22)/t13-/m0/s1 |
| InChIKey | VLBFPHKOGUOOOZ-ZDUSSCGKSA-N |
| XLogP | 2.30 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|