C14H18O5 — CID 174407683
4-hydroxy-7-[4-(hydroxymethyl)phenyl]-7-oxoheptanoic acid (PubChem CID 174407683) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is 4-hydroxy-7-[4-(hydroxymethyl)phenyl]-7-oxoheptanoic acid.
| Compound Name | 4-hydroxy-7-[4-(hydroxymethyl)phenyl]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 174407683 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 4-hydroxy-7-[4-(hydroxymethyl)phenyl]-7-oxoheptanoic acid |
| SMILES | O=C(O)CCC(O)CCC(=O)c1ccc(CO)cc1 |
| InChI | InChI=1S/C14H18O5/c15-9-10-1-3-11(4-2-10)13(17)7-5-12(16)6-8-14(18)19/h1-4,12,15-16H,5-9H2,(H,18,19) |
| InChIKey | OOYNMMGPBWGSAH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |