C20H22N2O3 — CID 174408811
2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]cyclohepta-2,4,6-triene-1-carbaldehyde (PubChem CID 174408811) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]cyclohepta-2,4,6-triene-1-carbaldehyde.
| Compound Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]cyclohepta-2,4,6-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 174408811 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]cyclohepta-2,4,6-triene-1-carbaldehyde |
| SMILES | O=CC1C=CC=CC=C1N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C20H22N2O3/c23-14-17-4-2-1-3-5-18(17)22-10-8-21(9-11-22)13-16-6-7-19-20(12-16)25-15-24-19/h1-7,12,14,17H,8-11,13,15H2 |
| InChIKey | JJTPIXMOMITKFQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|