C13H16FN5 — CID 174409290
(3R)-1-[2-fluoro-6-(triazol-1-ylmethyl)phenyl]pyrrolidin-3-amine (PubChem CID 174409290) has the molecular formula C13H16FN5 and a molecular weight of 261.30 g/mol. Its IUPAC name is (3R)-1-[2-fluoro-6-(triazol-1-ylmethyl)phenyl]pyrrolidin-3-amine.
| Compound Name | (3R)-1-[2-fluoro-6-(triazol-1-ylmethyl)phenyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 174409290 |
| Molecular Formula | C13H16FN5 |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | (3R)-1-[2-fluoro-6-(triazol-1-ylmethyl)phenyl]pyrrolidin-3-amine |
| SMILES | N[C@@H]1CCN(c2c(F)cccc2Cn2ccnn2)C1 |
| InChI | InChI=1S/C13H16FN5/c14-12-3-1-2-10(8-19-7-5-16-17-19)13(12)18-6-4-11(15)9-18/h1-3,5,7,11H,4,6,8-9,15H2/t11-/m1/s1 |
| InChIKey | HDIIPBVCXKIQJL-LLVKDONJSA-N |
| XLogP | 1.00 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |