C22H25OTi- — CID 174410274
3-methyl-5-phenylphenol;1,2,3,5-tetramethylcyclopenta-1,3-diene;titanium (PubChem CID 174410274) has the molecular formula C22H25OTi- and a molecular weight of 353.31 g/mol. Its IUPAC name is 3-methyl-5-phenylphenol;1,2,3,5-tetramethylcyclopenta-1,3-diene;titanium.
| Compound Name | 3-methyl-5-phenylphenol;1,2,3,5-tetramethylcyclopenta-1,3-diene;titanium |
|---|---|
| PubChem CID | 174410274 |
| Molecular Formula | C22H25OTi- |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 3-methyl-5-phenylphenol;1,2,3,5-tetramethylcyclopenta-1,3-diene;titanium |
| SMILES | CC1=[C-]C(C)C(C)=C1C.Cc1cc(O)cc(-c2ccccc2)c1.[Ti] |
| InChI | InChI=1S/C13H12O.C9H13.Ti/c1-10-7-12(9-13(14)8-10)11-5-3-2-4-6-11;1-6-5-7(2)9(4)8(6)3;/h2-9,14H,1H3;6H,1-4H3;/q;-1; |
| InChIKey | SUUFZKMAVOOZNJ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|