C18H26Zr — CID 18431322
bis(1,2,3,5-tetramethylcyclopenta-1,3-diene);zirconium(2+) (PubChem CID 18431322) has the molecular formula C18H26Zr and a molecular weight of 333.63 g/mol. Its IUPAC name is bis(1,2,3,5-tetramethylcyclopenta-1,3-diene);zirconium(2+).
| Compound Name | bis(1,2,3,5-tetramethylcyclopenta-1,3-diene);zirconium(2+) |
|---|---|
| PubChem CID | 18431322 |
| Molecular Formula | C18H26Zr |
| Molecular Weight | 333.63 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | bis(1,2,3,5-tetramethylcyclopenta-1,3-diene);zirconium(2+) |
| SMILES | CC1=[C-]C(C)C(C)=C1C.CC1=[C-]C(C)C(C)=C1C.[Zr+2] |
| InChI | InChI=1S/2C9H13.Zr/c2*1-6-5-7(2)9(4)8(6)3;/h2*6H,1-4H3;/q2*-1;+2 |
| InChIKey | KQOHBKQBYBAAFK-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.63 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|