C9H15F2Zr- — CID 174493495
1,2,3,5-tetramethylcyclopenta-1,3-diene;zirconium;dihydrofluoride (PubChem CID 174493495) has the molecular formula C9H15F2Zr- and a molecular weight of 252.44 g/mol. Its IUPAC name is 1,2,3,5-tetramethylcyclopenta-1,3-diene;zirconium;dihydrofluoride.
| Compound Name | 1,2,3,5-tetramethylcyclopenta-1,3-diene;zirconium;dihydrofluoride |
|---|---|
| PubChem CID | 174493495 |
| Molecular Formula | C9H15F2Zr- |
| Molecular Weight | 252.44 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | 1,2,3,5-tetramethylcyclopenta-1,3-diene;zirconium;dihydrofluoride |
| SMILES | CC1=[C-]C(C)C(C)=C1C.F.F.[Zr] |
| InChI | InChI=1S/C9H13.2FH.Zr/c1-6-5-7(2)9(4)8(6)3;;;/h6H,1-4H3;2*1H;/q-1;;; |
| InChIKey | LENSPHMYWPMERN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|