C15H19ClF3NO7S — CID 174417314
tert-butyl (2R)-2-(2-aminoacetyl)oxy-2-[4-(trifluoromethylsulfonyloxy)phenyl]acetate;hydrochloride (PubChem CID 174417314) has the molecular formula C15H19ClF3NO7S and a molecular weight of 449.83 g/mol. Its IUPAC name is tert-butyl (2R)-2-(2-aminoacetyl)oxy-2-[4-(trifluoromethylsulfonyloxy)phenyl]acetate;hydrochloride.
| Compound Name | tert-butyl (2R)-2-(2-aminoacetyl)oxy-2-[4-(trifluoromethylsulfonyloxy)phenyl]acetate;hydrochloride |
|---|---|
| PubChem CID | 174417314 |
| Molecular Formula | C15H19ClF3NO7S |
| Molecular Weight | 449.83 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | tert-butyl (2R)-2-(2-aminoacetyl)oxy-2-[4-(trifluoromethylsulfonyloxy)phenyl]acetate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)[C@H](OC(=O)CN)c1ccc(OS(=O)(=O)C(F)(F)F)cc1.Cl |
| InChI | InChI=1S/C15H18F3NO7S.ClH/c1-14(2,3)25-13(21)12(24-11(20)8-19)9-4-6-10(7-5-9)26-27(22,23)15(16,17)18;/h4-7,12H,8,19H2,1-3H3;1H/t12-;/m1./s1 |
| InChIKey | FWNVSNVFHTZUEA-UTONKHPSSA-N |
| XLogP | 2.22 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.83 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|