C16H23NO5S — CID 87275107
[1-(4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] (2S)-2-amino-3-sulfanylpropanoate (PubChem CID 87275107) has the molecular formula C16H23NO5S and a molecular weight of 341.43 g/mol. Its IUPAC name is [1-(4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] (2S)-2-amino-3-sulfanylpropanoate.
| Compound Name | [1-(4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] (2S)-2-amino-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 87275107 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | [1-(4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] (2S)-2-amino-3-sulfanylpropanoate |
| SMILES | COc1ccc(C(OC(=O)[C@H](N)CS)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H23NO5S/c1-16(2,3)22-15(19)13(21-14(18)12(17)9-23)10-5-7-11(20-4)8-6-10/h5-8,12-13,23H,9,17H2,1-4H3/t12-,13?/m1/s1 |
| InChIKey | YSSSLORJDXBSKW-PZORYLMUSA-N |
| XLogP | 1.88 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|