C11H13NO6S — CID 23034105
[2-amino-1-(4-methylsulfonyloxyphenyl)-2-oxoethyl] acetate (PubChem CID 23034105) has the molecular formula C11H13NO6S and a molecular weight of 287.29 g/mol. Its IUPAC name is [2-amino-1-(4-methylsulfonyloxyphenyl)-2-oxoethyl] acetate.
| Compound Name | [2-amino-1-(4-methylsulfonyloxyphenyl)-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 23034105 |
| Molecular Formula | C11H13NO6S |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | [2-amino-1-(4-methylsulfonyloxyphenyl)-2-oxoethyl] acetate |
| SMILES | CC(=O)OC(C(N)=O)c1ccc(OS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C11H13NO6S/c1-7(13)17-10(11(12)14)8-3-5-9(6-4-8)18-19(2,15)16/h3-6,10H,1-2H3,(H2,12,14) |
| InChIKey | OWWXPBZUCLDCSY-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|