C10H10FNO2 — CID 174418933
N-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)oxy]methanimine (PubChem CID 174418933) has the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. Its IUPAC name is N-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)oxy]methanimine.
| Compound Name | N-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)oxy]methanimine |
|---|---|
| PubChem CID | 174418933 |
| Molecular Formula | C10H10FNO2 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | N-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)oxy]methanimine |
| SMILES | C=NOC1CCOc2ccc(F)cc21 |
| InChI | InChI=1S/C10H10FNO2/c1-12-14-10-4-5-13-9-3-2-7(11)6-8(9)10/h2-3,6,10H,1,4-5H2 |
| InChIKey | FDYLFJJMCOHTTL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|