C23H23FN2O4 — CID 174419967
N-[(3,4-dimethoxy-5-nitrophenyl)-(4-fluorophenyl)methyl]-2-phenylethanamine (PubChem CID 174419967) has the molecular formula C23H23FN2O4 and a molecular weight of 410.45 g/mol. Its IUPAC name is N-[(3,4-dimethoxy-5-nitrophenyl)-(4-fluorophenyl)methyl]-2-phenylethanamine.
| Compound Name | N-[(3,4-dimethoxy-5-nitrophenyl)-(4-fluorophenyl)methyl]-2-phenylethanamine |
|---|---|
| PubChem CID | 174419967 |
| Molecular Formula | C23H23FN2O4 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | N-[(3,4-dimethoxy-5-nitrophenyl)-(4-fluorophenyl)methyl]-2-phenylethanamine |
| SMILES | COc1cc(C(NCCc2ccccc2)c2ccc(F)cc2)cc([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C23H23FN2O4/c1-29-21-15-18(14-20(26(27)28)23(21)30-2)22(17-8-10-19(24)11-9-17)25-13-12-16-6-4-3-5-7-16/h3-11,14-15,22,25H,12-13H2,1-2H3 |
| InChIKey | QFCUCDBPNRLUTD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|