C13H12N2O5 — CID 174420386
(Z)-2-(1H-1,4-benzodiazepin-2-yl)but-2-enedioic acid;hydrate (PubChem CID 174420386) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is (Z)-2-(1H-1,4-benzodiazepin-2-yl)but-2-enedioic acid;hydrate.
| Compound Name | (Z)-2-(1H-1,4-benzodiazepin-2-yl)but-2-enedioic acid;hydrate |
|---|---|
| PubChem CID | 174420386 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | (Z)-2-(1H-1,4-benzodiazepin-2-yl)but-2-enedioic acid;hydrate |
| SMILES | O.O=C(O)/C=C(\C(=O)O)C1=CN=Cc2ccccc2N1 |
| InChI | InChI=1S/C13H10N2O4.H2O/c16-12(17)5-9(13(18)19)11-7-14-6-8-3-1-2-4-10(8)15-11;/h1-7,15H,(H,16,17)(H,18,19);1H2/b9-5-; |
| InChIKey | DKUWUKCVNUOGGC-UYTGOYFPSA-N |
| XLogP | 0.64 |
| TPSA | 130.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|