C9H11N2O4P — CID 174831998
1H-1,4-benzodiazepine;phosphoric acid (PubChem CID 174831998) has the molecular formula C9H11N2O4P and a molecular weight of 242.17 g/mol. Its IUPAC name is 1H-1,4-benzodiazepine;phosphoric acid.
| Compound Name | 1H-1,4-benzodiazepine;phosphoric acid |
|---|---|
| PubChem CID | 174831998 |
| Molecular Formula | C9H11N2O4P |
| Molecular Weight | 242.17 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 1H-1,4-benzodiazepine;phosphoric acid |
| SMILES | C1=CNc2ccccc2C=N1.O=P(O)(O)O |
| InChI | InChI=1S/C9H8N2.H3O4P/c1-2-4-9-8(3-1)7-10-5-6-11-9;1-5(2,3)4/h1-7,11H;(H3,1,2,3,4) |
| InChIKey | ADHMNLGNMRVSAE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.17 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|