C10H9N3O2 — CID 69495406
1H-1,4-benzodiazepin-7-ylcarbamic acid (PubChem CID 69495406) has the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. Its IUPAC name is 1H-1,4-benzodiazepin-7-ylcarbamic acid.
| Compound Name | 1H-1,4-benzodiazepin-7-ylcarbamic acid |
|---|---|
| PubChem CID | 69495406 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 1H-1,4-benzodiazepin-7-ylcarbamic acid |
| SMILES | O=C(O)Nc1ccc2c(c1)C=NC=CN2 |
| InChI | InChI=1S/C10H9N3O2/c14-10(15)13-8-1-2-9-7(5-8)6-11-3-4-12-9/h1-6,12-13H,(H,14,15) |
| InChIKey | YHUPNOQKZLEBDT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |