About 1H-1,4-benzodiazepine;trihydrochloride
1H-1,4-benzodiazepine;trihydrochloride (PubChem CID 172746749) has the molecular formula C9H11Cl3N2
and a molecular weight of 253.56 g/mol. Its IUPAC name is 1H-1,4-benzodiazepine;trihydrochloride.
Molecular Properties
| Compound Name | 1H-1,4-benzodiazepine;trihydrochloride |
| PubChem CID | 172746749 |
| Molecular Formula | C9H11Cl3N2 |
| Molecular Weight | 253.56 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | 1H-1,4-benzodiazepine;trihydrochloride |
| SMILES | C1=CNc2ccccc2C=N1.Cl.Cl.Cl |
| InChI | InChI=1S/C9H8N2.3ClH/c1-2-4-9-8(3-1)7-10-5-6-11-9;;;/h1-7,11H;3*1H |
| InChIKey | JVDGWHQNXCWHGD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-1,4-benzodiazepine;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-1,4-benzodiazepine;trihydrochloride?
The IUPAC name of 1H-1,4-benzodiazepine;trihydrochloride (CID 172746749) is 1H-1,4-benzodiazepine;trihydrochloride.
What is the SMILES notation for 1H-1,4-benzodiazepine;trihydrochloride?
The canonical SMILES for 1H-1,4-benzodiazepine;trihydrochloride is C1=CNc2ccccc2C=N1.Cl.Cl.Cl.
What is the InChIKey of 1H-1,4-benzodiazepine;trihydrochloride?
The InChIKey is JVDGWHQNXCWHGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.3ClH/c1-2-4-9-8(3-1)7-10-5-6-11-9;;;/h1-7,11H;3*1H.
What are the key properties of 1H-1,4-benzodiazepine;trihydrochloride?
1H-1,4-benzodiazepine;trihydrochloride has a molecular weight of 253.56 g/mol, XLogP of 3.27, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-1,4-benzodiazepine;trihydrochloride is sourced from PubChem (CID 172746749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).