C8H7NS — CID 12805862
4H-1,4-benzothiazine (PubChem CID 12805862) has the molecular formula C8H7NS and a molecular weight of 149.22 g/mol. Its IUPAC name is 4H-1,4-benzothiazine.
| Compound Name | 4H-1,4-benzothiazine |
|---|---|
| PubChem CID | 12805862 |
| Molecular Formula | C8H7NS |
| Molecular Weight | 149.22 g/mol |
| Exact Mass | 149.03 |
| IUPAC Name | 4H-1,4-benzothiazine |
| SMILES | C1=CSc2ccccc2N1 |
| InChI | InChI=1S/C8H7NS/c1-2-4-8-7(3-1)9-5-6-10-8/h1-6,9H |
| InChIKey | ZLILRRGWBOKBIG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.22 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |