About 10H-phenothiazine;2H-thiazine
10H-phenothiazine;2H-thiazine (PubChem CID 141410254) has the molecular formula C16H14N2S2
and a molecular weight of 298.44 g/mol. Its IUPAC name is 10H-phenothiazine;2H-thiazine.
Molecular Properties
| Compound Name | 10H-phenothiazine;2H-thiazine |
| PubChem CID | 141410254 |
| Molecular Formula | C16H14N2S2 |
| Molecular Weight | 298.44 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 10H-phenothiazine;2H-thiazine |
| SMILES | C1=CNSC=C1.c1ccc2c(c1)Nc1ccccc1S2 |
| InChI | InChI=1S/C12H9NS.C4H5NS/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11;1-2-4-6-5-3-1/h1-8,13H;1-5H |
| InChIKey | KERORHSLVMZYDK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 10H-phenothiazine;2H-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10H-phenothiazine;2H-thiazine?
The IUPAC name of 10H-phenothiazine;2H-thiazine (CID 141410254) is 10H-phenothiazine;2H-thiazine.
What is the SMILES notation for 10H-phenothiazine;2H-thiazine?
The canonical SMILES for 10H-phenothiazine;2H-thiazine is C1=CNSC=C1.c1ccc2c(c1)Nc1ccccc1S2.
What is the InChIKey of 10H-phenothiazine;2H-thiazine?
The InChIKey is KERORHSLVMZYDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NS.C4H5NS/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11;1-2-4-6-5-3-1/h1-8,13H;1-5H.
What are the key properties of 10H-phenothiazine;2H-thiazine?
10H-phenothiazine;2H-thiazine has a molecular weight of 298.44 g/mol, XLogP of 5.16, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10H-phenothiazine;2H-thiazine is sourced from PubChem (CID 141410254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).