C9H7NS2 — CID 11446858
4H-1,4-benzothiazepine-5-thione (PubChem CID 11446858) has the molecular formula C9H7NS2 and a molecular weight of 193.30 g/mol. Its IUPAC name is 4H-1,4-benzothiazepine-5-thione.
| Compound Name | 4H-1,4-benzothiazepine-5-thione |
|---|---|
| PubChem CID | 11446858 |
| Molecular Formula | C9H7NS2 |
| Molecular Weight | 193.30 g/mol |
| Exact Mass | 193.00 |
| IUPAC Name | 4H-1,4-benzothiazepine-5-thione |
| SMILES | S=C1NC=CSc2ccccc21 |
| InChI | InChI=1S/C9H7NS2/c11-9-7-3-1-2-4-8(7)12-6-5-10-9/h1-6H,(H,10,11) |
| InChIKey | MKFFHOVEYXPGFM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|