C16H11NS — CID 22356010
8-thia-12-azatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),2,4,6,9,13,15,17-octaene (PubChem CID 22356010) has the molecular formula C16H11NS and a molecular weight of 249.34 g/mol. Its IUPAC name is 8-thia-12-azatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),2,4,6,9,13,15,17-octaene.
| Compound Name | 8-thia-12-azatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),2,4,6,9,13,15,17-octaene |
|---|---|
| PubChem CID | 22356010 |
| Molecular Formula | C16H11NS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 8-thia-12-azatetracyclo[9.7.0.02,7.013,18]octadeca-1(11),2,4,6,9,13,15,17-octaene |
| SMILES | C1=Cc2[nH]c3ccccc3c2-c2ccccc2S1 |
| InChI | InChI=1S/C16H11NS/c1-3-7-13-11(5-1)16-12-6-2-4-8-15(12)18-10-9-14(16)17-13/h1-10,17H |
| InChIKey | FZOOREMBWCYFOY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |