C15H11NO2S2 — CID 4247470
methyl 6-sulfanylidene-5H-benzo[b][1,4]benzothiazepine-3-carboxylate (PubChem CID 4247470) has the molecular formula C15H11NO2S2 and a molecular weight of 301.39 g/mol. Its IUPAC name is methyl 6-sulfanylidene-5H-benzo[b][1,4]benzothiazepine-3-carboxylate.
| Compound Name | methyl 6-sulfanylidene-5H-benzo[b][1,4]benzothiazepine-3-carboxylate |
|---|---|
| PubChem CID | 4247470 |
| Molecular Formula | C15H11NO2S2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | methyl 6-sulfanylidene-5H-benzo[b][1,4]benzothiazepine-3-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)NC(=S)c1ccccc1S2 |
| InChI | InChI=1S/C15H11NO2S2/c1-18-15(17)9-6-7-13-11(8-9)16-14(19)10-4-2-3-5-12(10)20-13/h2-8H,1H3,(H,16,19) |
| InChIKey | RSIUFYHSBQCZIT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|