C11H9NO3S — CID 176539202
methyl 3-(oxomethylidene)-4H-1,4-benzothiazine-6-carboxylate (PubChem CID 176539202) has the molecular formula C11H9NO3S and a molecular weight of 235.26 g/mol. Its IUPAC name is methyl 3-(oxomethylidene)-4H-1,4-benzothiazine-6-carboxylate.
| Compound Name | methyl 3-(oxomethylidene)-4H-1,4-benzothiazine-6-carboxylate |
|---|---|
| PubChem CID | 176539202 |
| Molecular Formula | C11H9NO3S |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | methyl 3-(oxomethylidene)-4H-1,4-benzothiazine-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)NC(=C=O)CS2 |
| InChI | InChI=1S/C11H9NO3S/c1-15-11(14)7-2-3-10-9(4-7)12-8(5-13)6-16-10/h2-4,12H,6H2,1H3 |
| InChIKey | NQZPXJHMKYHEHQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|