C11H8N2S2 — CID 69165458
2-(1,3-thiazol-2-yl)-4H-1,4-benzothiazine (PubChem CID 69165458) has the molecular formula C11H8N2S2 and a molecular weight of 232.33 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-yl)-4H-1,4-benzothiazine.
| Compound Name | 2-(1,3-thiazol-2-yl)-4H-1,4-benzothiazine |
|---|---|
| PubChem CID | 69165458 |
| Molecular Formula | C11H8N2S2 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | 2-(1,3-thiazol-2-yl)-4H-1,4-benzothiazine |
| SMILES | C1=C(c2nccs2)Sc2ccccc2N1 |
| InChI | InChI=1S/C11H8N2S2/c1-2-4-9-8(3-1)13-7-10(15-9)11-12-5-6-14-11/h1-7,13H |
| InChIKey | UHYGVGHIRAZVRI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |